C25H22N2O2S2 — CID 86961400
N-[3-(benzylsulfinylmethyl)phenyl]-4-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 86961400) has the molecular formula C25H22N2O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[3-(benzylsulfinylmethyl)phenyl]-4-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-[3-(benzylsulfinylmethyl)phenyl]-4-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86961400 |
| Molecular Formula | C25H22N2O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[3-(benzylsulfinylmethyl)phenyl]-4-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(-c2ccc(C(=O)Nc3cccc(CS(=O)Cc4ccccc4)c3)cc2)n1 |
| InChI | InChI=1S/C25H22N2O2S2/c1-18-15-30-25(26-18)22-12-10-21(11-13-22)24(28)27-23-9-5-8-20(14-23)17-31(29)16-19-6-3-2-4-7-19/h2-15H,16-17H2,1H3,(H,27,28) |
| InChIKey | LZHZTFFSJKQTKX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |