C20H37N3O2 — CID 86962853
N-propan-2-yl-3-[(2-propan-2-ylcyclohexyl)carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 86962853) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is N-propan-2-yl-3-[(2-propan-2-ylcyclohexyl)carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | N-propan-2-yl-3-[(2-propan-2-ylcyclohexyl)carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86962853 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | N-propan-2-yl-3-[(2-propan-2-ylcyclohexyl)carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCCC(NC(=O)NC2CCCCC2C(C)C)C1 |
| InChI | InChI=1S/C20H37N3O2/c1-13(2)17-10-5-6-11-18(17)23-20(25)22-16-9-7-8-15(12-16)19(24)21-14(3)4/h13-18H,5-12H2,1-4H3,(H,21,24)(H2,22,23,25) |
| InChIKey | CHAIEUWYCNJHGM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |