C16H15BrN2O3 — CID 86963083
N-(4-bromo-3-methylphenyl)-N,2-dimethyl-4-nitrobenzamide (PubChem CID 86963083) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N,2-dimethyl-4-nitrobenzamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N,2-dimethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 86963083 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N,2-dimethyl-4-nitrobenzamide |
| SMILES | Cc1cc(N(C)C(=O)c2ccc([N+](=O)[O-])cc2C)ccc1Br |
| InChI | InChI=1S/C16H15BrN2O3/c1-10-8-13(19(21)22)4-6-14(10)16(20)18(3)12-5-7-15(17)11(2)9-12/h4-9H,1-3H3 |
| InChIKey | SKMLVHKALGYQNB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|