C18H23N5O4S — CID 86964980
2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 86964980) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86964980 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | CCOC(C)c1nc(CC(=O)N2CCN(c3ccc([N+](=O)[O-])cn3)CC2)cs1 |
| InChI | InChI=1S/C18H23N5O4S/c1-3-27-13(2)18-20-14(12-28-18)10-17(24)22-8-6-21(7-9-22)16-5-4-15(11-19-16)23(25)26/h4-5,11-13H,3,6-10H2,1-2H3 |
| InChIKey | IYKZBDNOIAFCKD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|