C24H32N4O2S — CID 86968915
2-(oxolan-2-ylmethylsulfanyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide (PubChem CID 86968915) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 86968915 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)NC(=O)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C24H32N4O2S/c1-19(17-27-12-14-28(15-13-27)23-10-4-5-11-25-23)26-24(29)21-8-2-3-9-22(21)31-18-20-7-6-16-30-20/h2-5,8-11,19-20H,6-7,12-18H2,1H3,(H,26,29) |
| InChIKey | SMKIQPYKNXLRKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |