C23H24N4O2S — CID 86969128
4-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetyl]piperazin-1-yl]benzamide (PubChem CID 86969128) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 86969128 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetyl]piperazin-1-yl]benzamide |
| SMILES | Cc1nc(-c2ccc(CC(=O)N3CCN(c4ccc(C(N)=O)cc4)CC3)cc2)cs1 |
| InChI | InChI=1S/C23H24N4O2S/c1-16-25-21(15-30-16)18-4-2-17(3-5-18)14-22(28)27-12-10-26(11-13-27)20-8-6-19(7-9-20)23(24)29/h2-9,15H,10-14H2,1H3,(H2,24,29) |
| InChIKey | GIJHAXFFJDVUKP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |