C21H19Cl2N5O2 — CID 86969138
4-[4-[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]benzamide (PubChem CID 86969138) has the molecular formula C21H19Cl2N5O2 and a molecular weight of 444.32 g/mol. Its IUPAC name is 4-[4-[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 86969138 |
| Molecular Formula | C21H19Cl2N5O2 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 4-[4-[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C(=O)c3ccn(-c4ccc(Cl)c(Cl)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H19Cl2N5O2/c22-17-6-5-16(13-18(17)23)28-8-7-19(25-28)21(30)27-11-9-26(10-12-27)15-3-1-14(2-4-15)20(24)29/h1-8,13H,9-12H2,(H2,24,29) |
| InChIKey | AVADFWWBOJVQCN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |