C19H25N5O4S — CID 86969788
4-methyl-3-nitro-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzenesulfonamide (PubChem CID 86969788) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-3-nitro-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 86969788 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-methyl-3-nitro-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CN2CCN(c3ccccn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N5O4S/c1-15-6-7-17(13-18(15)24(25)26)29(27,28)21-16(2)14-22-9-11-23(12-10-22)19-5-3-4-8-20-19/h3-8,13,16,21H,9-12,14H2,1-2H3 |
| InChIKey | JIMUMPVQEKECMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|