C13H17BrN2S — CID 8696980
1-[(1S)-1-(4-bromophenyl)propyl]-3-prop-2-enylthiourea (PubChem CID 8696980) has the molecular formula C13H17BrN2S and a molecular weight of 313.26 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromophenyl)propyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[(1S)-1-(4-bromophenyl)propyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8696980 |
| Molecular Formula | C13H17BrN2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1-[(1S)-1-(4-bromophenyl)propyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N[C@@H](CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrN2S/c1-3-9-15-13(17)16-12(4-2)10-5-7-11(14)8-6-10/h3,5-8,12H,1,4,9H2,2H3,(H2,15,16,17)/t12-/m0/s1 |
| InChIKey | QGTQWKRXBCTKEI-LBPRGKRZSA-N |
| XLogP | 3.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|