C13H20N2OS — CID 9218078
1-ethyl-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea (PubChem CID 9218078) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-ethyl-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea.
| Compound Name | 1-ethyl-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 9218078 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-ethyl-3-[(1S)-1-(4-methoxyphenyl)propyl]thiourea |
| SMILES | CCNC(=S)N[C@@H](CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H20N2OS/c1-4-12(15-13(17)14-5-2)10-6-8-11(16-3)9-7-10/h6-9,12H,4-5H2,1-3H3,(H2,14,15,17)/t12-/m0/s1 |
| InChIKey | HZFYRDIYVOLKBA-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|