C21H24ClNO4 — CID 86969856
methyl 2-(2-chlorophenyl)-2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]acetate (PubChem CID 86969856) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]acetate |
|---|---|
| PubChem CID | 86969856 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylamino]acetate |
| SMILES | C=CCc1cc(CNC(C(=O)OC)c2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C21H24ClNO4/c1-5-8-15-11-14(12-18(25-2)20(15)26-3)13-23-19(21(24)27-4)16-9-6-7-10-17(16)22/h5-7,9-12,19,23H,1,8,13H2,2-4H3 |
| InChIKey | OETCRIWJSGYLGJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|