C18H16F3NO3S2 — CID 86970587
3-(2-methylsulfonylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 86970587) has the molecular formula C18H16F3NO3S2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-(2-methylsulfonylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 3-(2-methylsulfonylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 86970587 |
| Molecular Formula | C18H16F3NO3S2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-(2-methylsulfonylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CS(=O)(=O)c1ccccc1SC1CCN(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C18H16F3NO3S2/c1-27(24,25)16-5-3-2-4-14(16)26-15-10-11-22(17(15)23)13-8-6-12(7-9-13)18(19,20)21/h2-9,15H,10-11H2,1H3 |
| InChIKey | OGVKVWDSCAPWJN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |