C20H18ClF3N2O3 — CID 86970683
1-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-2-[2-(difluoromethoxy)phenyl]ethanone (PubChem CID 86970683) has the molecular formula C20H18ClF3N2O3 and a molecular weight of 426.82 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-2-[2-(difluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-2-[2-(difluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 86970683 |
| Molecular Formula | C20H18ClF3N2O3 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-2-[2-(difluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1OC(F)F)N1CCN(C(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C20H18ClF3N2O3/c21-14-5-6-16(22)15(12-14)19(28)26-9-7-25(8-10-26)18(27)11-13-3-1-2-4-17(13)29-20(23)24/h1-6,12,20H,7-11H2 |
| InChIKey | SRTHXKYXVCQYQQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |