C14H24N2O2S — CID 86970715
2-butoxy-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)acetamide (PubChem CID 86970715) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-butoxy-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-butoxy-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 86970715 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-butoxy-N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCOCC(=O)Nc1nc(CCC)c(CC)s1 |
| InChI | InChI=1S/C14H24N2O2S/c1-4-7-9-18-10-13(17)16-14-15-11(8-5-2)12(6-3)19-14/h4-10H2,1-3H3,(H,15,16,17) |
| InChIKey | QMPNUKRBVFEOSJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|