C23H27N3O2S — CID 86971206
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[3-(phenoxymethyl)piperidin-1-yl]ethanone (PubChem CID 86971206) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[3-(phenoxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[3-(phenoxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 86971206 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[3-(phenoxymethyl)piperidin-1-yl]ethanone |
| SMILES | CC(SCC(=O)N1CCCC(COc2ccccc2)C1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H27N3O2S/c1-17(23-24-20-11-5-6-12-21(20)25-23)29-16-22(27)26-13-7-8-18(14-26)15-28-19-9-3-2-4-10-19/h2-6,9-12,17-18H,7-8,13-16H2,1H3,(H,24,25) |
| InChIKey | UJLTWHHOZHNZAT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |