C18H26N4OS — CID 119435358
1-[2-(1-aminoethyl)piperidin-1-yl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethanone (PubChem CID 119435358) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)piperidin-1-yl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethanone.
| Compound Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethanone |
|---|---|
| PubChem CID | 119435358 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[2-(1-aminoethyl)piperidin-1-yl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethanone |
| SMILES | CC(SCC(=O)N1CCCCC1C(C)N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H26N4OS/c1-12(19)16-9-5-6-10-22(16)17(23)11-24-13(2)18-20-14-7-3-4-8-15(14)21-18/h3-4,7-8,12-13,16H,5-6,9-11,19H2,1-2H3,(H,20,21) |
| InChIKey | FLCHZCJDBMILJA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |