C18H26N4OS — CID 119610093
N-[2-(aminomethyl)cyclohexyl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide (PubChem CID 119610093) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 119610093 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide |
| SMILES | CC(SCC(=O)NC1CCCCC1CN)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H26N4OS/c1-12(18-21-15-8-4-5-9-16(15)22-18)24-11-17(23)20-14-7-3-2-6-13(14)10-19/h4-5,8-9,12-14H,2-3,6-7,10-11,19H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | VZRXHGISNGOXQY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |