C19H27N3OS — CID 78864043
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-(2-ethylcyclohexyl)acetamide (PubChem CID 78864043) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-(2-ethylcyclohexyl)acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-(2-ethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 78864043 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-(2-ethylcyclohexyl)acetamide |
| SMILES | CCC1CCCCC1NC(=O)CSC(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H27N3OS/c1-3-14-8-4-5-9-15(14)20-18(23)12-24-13(2)19-21-16-10-6-7-11-17(16)22-19/h6-7,10-11,13-15H,3-5,8-9,12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | NXFBEQOUDWNWGN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |