C15H22N4OS — CID 119522351
N-(1-amino-2-methylpropan-2-yl)-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide (PubChem CID 119522351) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 119522351 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetamide |
| SMILES | CC(SCC(=O)NC(C)(C)CN)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H22N4OS/c1-10(21-8-13(20)19-15(2,3)9-16)14-17-11-6-4-5-7-12(11)18-14/h4-7,10H,8-9,16H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | WCQKLFHZDGOTQV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |