C14H17N3O3S — CID 119369735
(2R)-2-[[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetyl]amino]propanoic acid (PubChem CID 119369735) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is (2R)-2-[[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119369735 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2R)-2-[[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]acetyl]amino]propanoic acid |
| SMILES | CC(SCC(=O)N[C@H](C)C(=O)O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H17N3O3S/c1-8(14(19)20)15-12(18)7-21-9(2)13-16-10-5-3-4-6-11(10)17-13/h3-6,8-9H,7H2,1-2H3,(H,15,18)(H,16,17)(H,19,20)/t8-,9?/m1/s1 |
| InChIKey | XJKBLJIYTVUTSP-VEDVMXKPSA-N |
| XLogP | 1.95 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |