C20H24N4OS — CID 119439314
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-(ethylaminomethyl)phenyl]acetamide (PubChem CID 119439314) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-(ethylaminomethyl)phenyl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-(ethylaminomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 119439314 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-(ethylaminomethyl)phenyl]acetamide |
| SMILES | CCNCc1ccccc1NC(=O)CSC(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H24N4OS/c1-3-21-12-15-8-4-5-9-16(15)22-19(25)13-26-14(2)20-23-17-10-6-7-11-18(17)24-20/h4-11,14,21H,3,12-13H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | ALZKUIUVFKHTMM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |