C19H18N4OS — CID 9260769
2-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 9260769) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9260769 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]sulfanyl-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | C[C@H](SCC(=O)Nc1ccc(CC#N)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H18N4OS/c1-13(19-22-16-4-2-3-5-17(16)23-19)25-12-18(24)21-15-8-6-14(7-9-15)10-11-20/h2-9,13H,10,12H2,1H3,(H,21,24)(H,22,23)/t13-/m0/s1 |
| InChIKey | SJONQKZEDXSADY-ZDUSSCGKSA-N |
| XLogP | 4.06 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |