C24H31N5OS — CID 78776040
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide (PubChem CID 78776040) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 78776040 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CSC(C)c3nc4ccccc4[nH]3)c(C)c2)CC1 |
| InChI | InChI=1S/C24H31N5OS/c1-4-28-11-13-29(14-12-28)19-9-10-20(17(2)15-19)25-23(30)16-31-18(3)24-26-21-7-5-6-8-22(21)27-24/h5-10,15,18H,4,11-14,16H2,1-3H3,(H,25,30)(H,26,27) |
| InChIKey | HJDXPRVHMJJOCT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|