C24H30N4OS — CID 112822452
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide (PubChem CID 112822452) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 112822452 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
| SMILES | CC(SCC(=O)NC1CCN(CCc2ccccc2)CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H30N4OS/c1-18(24-26-21-9-5-6-10-22(21)27-24)30-17-23(29)25-20-12-15-28(16-13-20)14-11-19-7-3-2-4-8-19/h2-10,18,20H,11-17H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | WIWGKXQDKHDZRB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |