C24H27N3O3 — CID 86971207
[1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]-[3-(phenoxymethyl)piperidin-1-yl]methanone (PubChem CID 86971207) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]-[3-(phenoxymethyl)piperidin-1-yl]methanone.
| Compound Name | [1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]-[3-(phenoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86971207 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]-[3-(phenoxymethyl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C)cc1-n1ccc(C(=O)N2CCCC(COc3ccccc3)C2)n1 |
| InChI | InChI=1S/C24H27N3O3/c1-18-10-11-23(29-2)22(15-18)27-14-12-21(25-27)24(28)26-13-6-7-19(16-26)17-30-20-8-4-3-5-9-20/h3-5,8-12,14-15,19H,6-7,13,16-17H2,1-2H3 |
| InChIKey | LQAIEQOREDQSGM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |