C16H15Cl2NO3S2 — CID 86971491
2-(2,5-dichlorophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)acetamide (PubChem CID 86971491) has the molecular formula C16H15Cl2NO3S2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 86971491 |
| Molecular Formula | C16H15Cl2NO3S2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1cccc(NC(=O)CSc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO3S2/c1-2-24(21,22)13-5-3-4-12(9-13)19-16(20)10-23-15-8-11(17)6-7-14(15)18/h3-9H,2,10H2,1H3,(H,19,20) |
| InChIKey | YPGGPYAHIQFRBZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |