C17H17Cl2NOS — CID 7870586
2-(2,5-dichlorophenyl)sulfanyl-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 7870586) has the molecular formula C17H17Cl2NOS and a molecular weight of 354.30 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7870586 |
| Molecular Formula | C17H17Cl2NOS |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2NOS/c1-11(2)13-5-3-4-6-15(13)20-17(21)10-22-16-9-12(18)7-8-14(16)19/h3-9,11H,10H2,1-2H3,(H,20,21) |
| InChIKey | MZGXFQUDECBRDN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |