C18H16Cl2N2O2S — CID 42238821
2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 42238821) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 42238821 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C18H16Cl2N2O2S/c19-12-7-8-13(20)16(10-12)25-11-17(23)21-14-4-1-2-5-15(14)22-9-3-6-18(22)24/h1-2,4-5,7-8,10H,3,6,9,11H2,(H,21,23) |
| InChIKey | RUEJKBYBZXLBSP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |