C17H14Cl2N2O2 — CID 26709772
2,5-dichloro-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 26709772) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26709772 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2,5-dichloro-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-11-7-8-13(19)12(10-11)17(23)20-14-4-1-2-5-15(14)21-9-3-6-16(21)22/h1-2,4-5,7-8,10H,3,6,9H2,(H,20,23) |
| InChIKey | HHNWBMDKIBGVOW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |