C21H22ClN3O5S — CID 43013801
2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 43013801) has the molecular formula C21H22ClN3O5S and a molecular weight of 463.94 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 43013801 |
| Molecular Formula | C21H22ClN3O5S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C21H22ClN3O5S/c22-17-8-7-15(31(28,29)24-10-12-30-13-11-24)14-16(17)21(27)23-18-4-1-2-5-19(18)25-9-3-6-20(25)26/h1-2,4-5,7-8,14H,3,6,9-13H2,(H,23,27) |
| InChIKey | ZLZIIJRXWPTIQK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |