C26H35N3O3 — CID 86972166
N,N-diethyl-3-[2-[3-(phenoxymethyl)piperidin-1-yl]propanoylamino]benzamide (PubChem CID 86972166) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is N,N-diethyl-3-[2-[3-(phenoxymethyl)piperidin-1-yl]propanoylamino]benzamide.
| Compound Name | N,N-diethyl-3-[2-[3-(phenoxymethyl)piperidin-1-yl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 86972166 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | N,N-diethyl-3-[2-[3-(phenoxymethyl)piperidin-1-yl]propanoylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C(C)N2CCCC(COc3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H35N3O3/c1-4-28(5-2)26(31)22-12-9-13-23(17-22)27-25(30)20(3)29-16-10-11-21(18-29)19-32-24-14-7-6-8-15-24/h6-9,12-15,17,20-21H,4-5,10-11,16,18-19H2,1-3H3,(H,27,30) |
| InChIKey | WVWCAWXBYJWTKM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |