C17H20N2O3S — CID 86972342
1-[(5-nitrothiophen-3-yl)methyl]-3-(phenoxymethyl)piperidine (PubChem CID 86972342) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[(5-nitrothiophen-3-yl)methyl]-3-(phenoxymethyl)piperidine.
| Compound Name | 1-[(5-nitrothiophen-3-yl)methyl]-3-(phenoxymethyl)piperidine |
|---|---|
| PubChem CID | 86972342 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[(5-nitrothiophen-3-yl)methyl]-3-(phenoxymethyl)piperidine |
| SMILES | O=[N+]([O-])c1cc(CN2CCCC(COc3ccccc3)C2)cs1 |
| InChI | InChI=1S/C17H20N2O3S/c20-19(21)17-9-15(13-23-17)11-18-8-4-5-14(10-18)12-22-16-6-2-1-3-7-16/h1-3,6-7,9,13-14H,4-5,8,10-12H2 |
| InChIKey | HVQDMYJBEBVVQE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|