C19H21BrN2O2 — CID 86973251
1-[1-(4-bromophenyl)cyclopropyl]-3-[3-(4-hydroxyphenyl)propyl]urea (PubChem CID 86973251) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)cyclopropyl]-3-[3-(4-hydroxyphenyl)propyl]urea.
| Compound Name | 1-[1-(4-bromophenyl)cyclopropyl]-3-[3-(4-hydroxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 86973251 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-[1-(4-bromophenyl)cyclopropyl]-3-[3-(4-hydroxyphenyl)propyl]urea |
| SMILES | O=C(NCCCc1ccc(O)cc1)NC1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H21BrN2O2/c20-16-7-5-15(6-8-16)19(11-12-19)22-18(24)21-13-1-2-14-3-9-17(23)10-4-14/h3-10,23H,1-2,11-13H2,(H2,21,22,24) |
| InChIKey | GMATWJQPLIPWII-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|