C19H19F3N2O3S — CID 86973705
ethyl 2-[ethyl-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate (PubChem CID 86973705) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is ethyl 2-[ethyl-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[ethyl-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 86973705 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethyl 2-[ethyl-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CC)C(=O)CSc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H19F3N2O3S/c1-3-24(15-8-6-5-7-14(15)18(26)27-4-2)17(25)12-28-16-10-9-13(11-23-16)19(20,21)22/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | VHYBIVNMQJKPTI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |