C18H17FN2O — CID 86979034
N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide (PubChem CID 86979034) has the molecular formula C18H17FN2O and a molecular weight of 296.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 86979034 |
| Molecular Formula | C18H17FN2O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1ccc(N(CCC#N)C(=O)c2ccccc2F)cc1C |
| InChI | InChI=1S/C18H17FN2O/c1-13-8-9-15(12-14(13)2)21(11-5-10-20)18(22)16-6-3-4-7-17(16)19/h3-4,6-9,12H,5,11H2,1-2H3 |
| InChIKey | LTTKVSWTOQPRJG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |