C18H13N3O2S2 — CID 86979352
2-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 86979352) has the molecular formula C18H13N3O2S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 86979352 |
| Molecular Formula | C18H13N3O2S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H13N3O2S2/c22-16(11-24-18-20-13-8-4-5-9-14(13)23-18)21-17-19-10-15(25-17)12-6-2-1-3-7-12/h1-10H,11H2,(H,19,21,22) |
| InChIKey | CBDNSLKDGAOEPV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |