C17H15N3OS — CID 86981800
3-(2,3-dimethyl-1H-indol-7-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanenitrile (PubChem CID 86981800) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-(2,3-dimethyl-1H-indol-7-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanenitrile.
| Compound Name | 3-(2,3-dimethyl-1H-indol-7-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 86981800 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-(2,3-dimethyl-1H-indol-7-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanenitrile |
| SMILES | Cc1csc(C(C#N)C(=O)c2cccc3c(C)c(C)[nH]c23)n1 |
| InChI | InChI=1S/C17H15N3OS/c1-9-8-22-17(19-9)14(7-18)16(21)13-6-4-5-12-10(2)11(3)20-15(12)13/h4-6,8,14,20H,1-3H3 |
| InChIKey | OVPGYDWSOHGQJE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|