C20H28N6O2 — CID 86985701
N-butan-2-yl-2-[4-[1-(4-methylphenyl)triazole-4-carbonyl]piperazin-1-yl]acetamide (PubChem CID 86985701) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-[1-(4-methylphenyl)triazole-4-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-[1-(4-methylphenyl)triazole-4-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 86985701 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-butan-2-yl-2-[4-[1-(4-methylphenyl)triazole-4-carbonyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)c2cn(-c3ccc(C)cc3)nn2)CC1 |
| InChI | InChI=1S/C20H28N6O2/c1-4-16(3)21-19(27)14-24-9-11-25(12-10-24)20(28)18-13-26(23-22-18)17-7-5-15(2)6-8-17/h5-8,13,16H,4,9-12,14H2,1-3H3,(H,21,27) |
| InChIKey | KGAIDZJZUAEPMI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |