C14H20F3N3O2 — CID 86990553
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-oxo-1-pyridinyl)propanamide (PubChem CID 86990553) has the molecular formula C14H20F3N3O2 and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 86990553 |
| Molecular Formula | C14H20F3N3O2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-oxo-1-pyridinyl)propanamide |
| SMILES | CN(CCCNC(=O)CCn1ccccc1=O)CC(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O2/c1-19(11-14(15,16)17)8-4-7-18-12(21)6-10-20-9-3-2-5-13(20)22/h2-3,5,9H,4,6-8,10-11H2,1H3,(H,18,21) |
| InChIKey | VIZRWDXBBSPONG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|