C21H29N3O5 — CID 8699192
ethyl 4-[2-[(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate (PubChem CID 8699192) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is ethyl 4-[2-[(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 8699192 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | ethyl 4-[2-[(E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)/C=C/c2cc(C)n(C3CC3)c2C)CC1 |
| InChI | InChI=1S/C21H29N3O5/c1-4-28-21(27)23-11-9-22(10-12-23)19(25)14-29-20(26)8-5-17-13-15(2)24(16(17)3)18-6-7-18/h5,8,13,18H,4,6-7,9-12,14H2,1-3H3/b8-5+ |
| InChIKey | LXMWLQWEKJVOMN-VMPITWQZSA-N |
| XLogP | 2.30 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|