C22H33N5O2 — CID 86993137
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]urea (PubChem CID 86993137) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 86993137 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]urea |
| SMILES | Cc1cccc(C(CNC(=O)NCCCn2nc(C)cc2C)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H33N5O2/c1-17-6-4-7-20(14-17)21(26-10-12-29-13-11-26)16-24-22(28)23-8-5-9-27-19(3)15-18(2)25-27/h4,6-7,14-15,21H,5,8-13,16H2,1-3H3,(H2,23,24,28) |
| InChIKey | ABDUHSIBYJDLRP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|