C17H20F3N3O3 — CID 86993326
1-benzyl-6-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxamide (PubChem CID 86993326) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-benzyl-6-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-benzyl-6-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 86993326 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-benzyl-6-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(NCCCOCC(F)(F)F)C1=NN(Cc2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C17H20F3N3O3/c18-17(19,20)12-26-10-4-9-21-16(25)14-7-8-15(24)23(22-14)11-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2,(H,21,25) |
| InChIKey | ANODJZLEWXLJIL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|