C24H27FN4O4 — CID 55802024
N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 55802024) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55802024 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)C2=NN(Cc3ccc(F)cc3)C(=O)CC2)c1 |
| InChI | InChI=1S/C24H27FN4O4/c1-2-33-14-4-13-26-23(31)18-5-3-6-20(15-18)27-24(32)21-11-12-22(30)29(28-21)16-17-7-9-19(25)10-8-17/h3,5-10,15H,2,4,11-14,16H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | AUKPJCVUIXJQJV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|