C16H26N2O4 — CID 86993788
methyl 7-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]heptanoate (PubChem CID 86993788) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 7-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]heptanoate.
| Compound Name | methyl 7-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]heptanoate |
|---|---|
| PubChem CID | 86993788 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | methyl 7-[1-(5-methylfuran-2-yl)ethylcarbamoylamino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)NC(C)c1ccc(C)o1 |
| InChI | InChI=1S/C16H26N2O4/c1-12-9-10-14(22-12)13(2)18-16(20)17-11-7-5-4-6-8-15(19)21-3/h9-10,13H,4-8,11H2,1-3H3,(H2,17,18,20) |
| InChIKey | JESCASPMCCQLMC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|