C16H20N2O5 — CID 51081982
methyl 2-methyl-5-[[1-(5-methylfuran-2-yl)ethylcarbamoylamino]methyl]furan-3-carboxylate (PubChem CID 51081982) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 2-methyl-5-[[1-(5-methylfuran-2-yl)ethylcarbamoylamino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[1-(5-methylfuran-2-yl)ethylcarbamoylamino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 51081982 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 2-methyl-5-[[1-(5-methylfuran-2-yl)ethylcarbamoylamino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(=O)NC(C)c2ccc(C)o2)oc1C |
| InChI | InChI=1S/C16H20N2O5/c1-9-5-6-14(22-9)10(2)18-16(20)17-8-12-7-13(11(3)23-12)15(19)21-4/h5-7,10H,8H2,1-4H3,(H2,17,18,20) |
| InChIKey | BIUZTNGEYXEGTP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |