C17H23F3N2O2 — CID 86994280
1-[3-(cyclopropylmethoxy)propyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 86994280) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 86994280 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NCCCOCC1CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O2/c1-12(14-5-7-15(8-6-14)17(18,19)20)22-16(23)21-9-2-10-24-11-13-3-4-13/h5-8,12-13H,2-4,9-11H2,1H3,(H2,21,22,23) |
| InChIKey | PDVXVVOEPBQLLM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|