C16H19BrN2O3 — CID 86995112
1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(4-propan-2-yloxyphenyl)urea (PubChem CID 86995112) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(4-propan-2-yloxyphenyl)urea.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(4-propan-2-yloxyphenyl)urea |
|---|---|
| PubChem CID | 86995112 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-1-methyl-3-(4-propan-2-yloxyphenyl)urea |
| SMILES | CC(C)Oc1ccc(NC(=O)N(C)Cc2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C16H19BrN2O3/c1-11(2)21-13-6-4-12(5-7-13)18-16(20)19(3)10-14-8-9-15(17)22-14/h4-9,11H,10H2,1-3H3,(H,18,20) |
| InChIKey | HOQGYVQDVQPUEW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |