C18H26N4O2 — CID 86995782
1-[2-(4-propan-2-ylphenoxy)ethyl]-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 86995782) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[2-(4-propan-2-ylphenoxy)ethyl]-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[2-(4-propan-2-ylphenoxy)ethyl]-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 86995782 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[2-(4-propan-2-ylphenoxy)ethyl]-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | CC(C)c1ccc(OCCNC(=O)NCCCn2cccn2)cc1 |
| InChI | InChI=1S/C18H26N4O2/c1-15(2)16-5-7-17(8-6-16)24-14-11-20-18(23)19-9-3-12-22-13-4-10-21-22/h4-8,10,13,15H,3,9,11-12,14H2,1-2H3,(H2,19,20,23) |
| InChIKey | WXXCOEADTVTCFM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|