About 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide
2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide (PubChem CID 86998087) has the molecular formula C17H21Cl2N3O
and a molecular weight of 354.28 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide |
| PubChem CID | 86998087 |
| Molecular Formula | C17H21Cl2N3O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2Cl)c(C)c1CC(=O)N(C)C(C)C |
| InChI | InChI=1S/C17H21Cl2N3O/c1-10(2)21(5)17(23)9-14-11(3)20-22(12(14)4)16-7-6-13(18)8-15(16)19/h6-8,10H,9H2,1-5H3 |
| InChIKey | XJUPHKZULGAMGR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide?
The IUPAC name of 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide (CID 86998087) is 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide?
The canonical SMILES for 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide is Cc1nn(-c2ccc(Cl)cc2Cl)c(C)c1CC(=O)N(C)C(C)C.
What is the InChIKey of 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide?
The InChIKey is XJUPHKZULGAMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2N3O/c1-10(2)21(5)17(23)9-14-11(3)20-22(12(14)4)16-7-6-13(18)8-15(16)19/h6-8,10H,9H2,1-5H3.
What are the key properties of 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide?
2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide has a molecular weight of 354.28 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-methyl-N-propan-2-ylacetamide is sourced from PubChem (CID 86998087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).