C19H27N3OS — CID 86999613
1-[2-(1-benzothiophen-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)urea (PubChem CID 86999613) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-[2-(1-benzothiophen-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 86999613 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[2-(1-benzothiophen-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)urea |
| SMILES | CC(C)N1CCC(NC(=O)NCCc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C19H27N3OS/c1-14(2)22-11-8-16(9-12-22)21-19(23)20-10-7-15-13-24-18-6-4-3-5-17(15)18/h3-6,13-14,16H,7-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | ZAHNJFYSMROWBE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |